CAS 86864-59-7 appears in our catalog under these names: 5-[(tert-Butyldimethylsilyl)oxy]pentan-2-one, 96%, 5-((tert-Butyldimethylsilyl)oxy)pentan-2-one, 5-((tert-Butyldimethylsilyl)oxy)pentan-2-one 95%. Offered by: Combi-blocks, Biosynth, Ambeed. Available pack sizes: 5g, 1g, 0,5g, 25g.
5-[tert-butyl(dimethyl)silyl]oxypentan-2-one (CAS 86864-59-7) is a chemical compound with the molecular formula C11H24O2Si and a molecular weight of 216.39 g/mol. IUPAC name: 5-[tert-butyl(dimethyl)silyl]oxypentan-2-one. InChIKey: HYMOZAQHSDGTIS-UHFFFAOYSA-N.
| Molecular formula | C11H24O2Si |
|---|---|
| Molecular weight | 216.39 g/mol |
| IUPAC name | 5-[tert-butyl(dimethyl)silyl]oxypentan-2-one |
| InChIKey | HYMOZAQHSDGTIS-UHFFFAOYSA-N |
| SMILES | CC(=O)CCCO[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)