Products 204917-42-0
CAS 204917-42-0 is the registry number for (S)-4-((tert-Butyldimethylsilyl)oxy)-3-methylbutanal, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[tert-butyl(dimethyl)silyl]oxy-3-methylbutanal (CAS 204917-42-0) is a chemical compound with the molecular formula C11H24O2Si and a molecular weight of 216.39 g/mol. IUPAC name: 4-[tert-butyl(dimethyl)silyl]oxy-3-methylbutanal. InChIKey: XNTGGGQCYBRHIO-UHFFFAOYSA-N.
| Molecular formula | C11H24O2Si |
|---|---|
| Molecular weight | 216.39 g/mol |
| IUPAC name | 4-[tert-butyl(dimethyl)silyl]oxy-3-methylbutanal |
| InChIKey | XNTGGGQCYBRHIO-UHFFFAOYSA-N |
| SMILES | CC(CC=O)CO[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)