CAS 183162-25-6 is the registry number for 1-{[(tert-Butyldimethylsilyl)oxy]methyl}cyclobutan-1-ol, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclobutan-1-ol (CAS 183162-25-6) is a chemical compound with the molecular formula C11H24O2Si and a molecular weight of 216.39 g/mol. IUPAC name: 1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclobutan-1-ol. InChIKey: YEDLWHJZZRRBGH-UHFFFAOYSA-N.
| Molecular formula | C11H24O2Si |
|---|---|
| Molecular weight | 216.39 g/mol |
| IUPAC name | 1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclobutan-1-ol |
| InChIKey | YEDLWHJZZRRBGH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1(CCC1)O |
Computed by PubChem (NCBI)