cas: 1220219-36-2 — see every product listed under this CAS number, including other names
(1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclopropyl)methanol, 98%, 98% (CAS 1220219-36-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1127N5-5g |
| cas | 1220219-36-2 |
| size | 5g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 4490.00 Pln | |
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 947.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropyl]methanol (CAS 1220219-36-2) is a chemical compound with the molecular formula C16H23BO3 and a molecular weight of 274.2 g/mol. IUPAC name: [1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropyl]methanol. InChIKey: WLKBNPVGNWGUSP-UHFFFAOYSA-N.
| Molecular formula | C16H23BO3 |
|---|---|
| Molecular weight | 274.2 g/mol |
| IUPAC name | [1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropyl]methanol |
| InChIKey | WLKBNPVGNWGUSP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3(CC3)CO |
Computed by PubChem (NCBI)