Products 1450835-27-4
CAS 1450835-27-4 appears in our catalog under these names: 2-(3,3-Dimethyl-1,3-dihydroisobenzofuran-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 3,3-Dimethyl-1,3-dihydroisobenzofurane-5-boronic Acid Pinacol Ester, >95%, >95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
2-(3,3-dimethyl-1H-2-benzofuran-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1450835-27-4) is a chemical compound with the molecular formula C16H23BO3 and a molecular weight of 274.2 g/mol. IUPAC name: 2-(3,3-dimethyl-1H-2-benzofuran-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DWTYYBVEWWWQET-UHFFFAOYSA-N.
| Molecular formula | C16H23BO3 |
|---|---|
| Molecular weight | 274.2 g/mol |
| IUPAC name | 2-(3,3-dimethyl-1H-2-benzofuran-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DWTYYBVEWWWQET-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(COC3(C)C)C=C2 |
Computed by PubChem (NCBI)