CAS 1312478-69-5 is the registry number for Rel-(1s,3s)-3-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclobutan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutan-1-ol (CAS 1312478-69-5) is a chemical compound with the molecular formula C16H23BO3 and a molecular weight of 274.2 g/mol. IUPAC name: 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutan-1-ol. InChIKey: CGODDFPGKPUIBG-UHFFFAOYSA-N.
| Molecular formula | C16H23BO3 |
|---|---|
| Molecular weight | 274.2 g/mol |
| IUPAC name | 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutan-1-ol |
| InChIKey | CGODDFPGKPUIBG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3CC(C3)O |
Computed by PubChem (NCBI)