CAS 2096332-77-1 appears in our catalog under these names: 1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)butan-1-one 97%, 1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)butan-1-one, 97%, 4-Butanoylphenylboronic acid, pinacol ester, 98%, 4-Butanoylphenylboronic acid, pinacol ester, 97%, 97%. Offered by: Ambeed, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 5g.
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-1-one (CAS 2096332-77-1) is a chemical compound with the molecular formula C16H23BO3 and a molecular weight of 274.2 g/mol. IUPAC name: 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-1-one. InChIKey: KXACZLKHSCCLGY-UHFFFAOYSA-N.
| Molecular formula | C16H23BO3 |
|---|---|
| Molecular weight | 274.2 g/mol |
| IUPAC name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-1-one |
| InChIKey | KXACZLKHSCCLGY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)CCC |
Computed by PubChem (NCBI)