cas: 913835-81-1 — see every product listed under this CAS number, including other names
(1-(tert-Butoxycarbonyl)-7-methoxy-1H-indol-2-yl)boronic acid, 98% (CAS 913835-81-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A333783-25g |
| cas | 913835-81-1 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 14287.84 Pln | |
| AmBeed | 10g | 8109.85 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
[7-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (CAS 913835-81-1) is a chemical compound with the molecular formula C14H18BNO5 and a molecular weight of 291.11 g/mol. IUPAC name: [7-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. InChIKey: JYRDIGLHLIDRNE-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO5 |
|---|---|
| Molecular weight | 291.11 g/mol |
| IUPAC name | [7-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChIKey | JYRDIGLHLIDRNE-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C(=CC=C2)OC)(O)O |
Computed by PubChem (NCBI)