CAS 290331-71-4 appears in our catalog under these names: 1-BOC-5-methoxyindole-2-boronic acid, 98%, 1–Boc–5–methoxyindole–2–boronic acid, 1-Boc-5-methoxyindole-2-boronic acid, 95% , (1-(tert-Butoxycarbonyl)-5-methoxy-1H-indol-2-yl)boronic acid 98%, N-BOC-5-METHOXY-2-INDOLYLBORONIC ACID, &. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Sigma-Aldrich. Available pack sizes: 5g, 25g, 100g, 1g, 100mg, 250mg, 10g.
[5-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (CAS 290331-71-4) is a chemical compound with the molecular formula C14H18BNO5 and a molecular weight of 291.11 g/mol. IUPAC name: [5-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. InChIKey: PZLVPMBCKHDVKT-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO5 |
|---|---|
| Molecular weight | 291.11 g/mol |
| IUPAC name | [5-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChIKey | PZLVPMBCKHDVKT-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC(=C2)OC)(O)O |
Computed by PubChem (NCBI)