CAS 913835-81-1 appears in our catalog under these names: 1-BOC-7-methoxyindole-2-boronic acid, 98%, (1-(tert-Butoxycarbonyl)-7-methoxy-1H-indol-2-yl)boronic acid, 95-<97%, (1-(tert-Butoxycarbonyl)-7-methoxy-1H-indol-2-yl)boronic acid, ≥97-<99%, (1-(tert-Butoxycarbonyl)-7-methoxy-1H-indol-2-yl)boronic acid, 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed. Available pack sizes: 5g, 1g, 10g, 25g, 50g, 100g, 200g, 300g.
[7-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (CAS 913835-81-1) is a chemical compound with the molecular formula C14H18BNO5 and a molecular weight of 291.11 g/mol. IUPAC name: [7-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. InChIKey: JYRDIGLHLIDRNE-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO5 |
|---|---|
| Molecular weight | 291.11 g/mol |
| IUPAC name | [7-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChIKey | JYRDIGLHLIDRNE-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C(=CC=C2)OC)(O)O |
Computed by PubChem (NCBI)