CAS 1000068-23-4 appears in our catalog under these names: 1H-Indole-1-carboxylic acid, 2-borono-4-methoxy-, 1-(1,1-dimethylethyl) ester, 98%, (1-(tert-Butoxycarbonyl)-4-methoxy-1H-indol-2-yl)boronic acid 98+%, (1-(tert-butoxycarbonyl)-4-methoxy-1H-indol-2-yl)boronic acid, 97%, 97%, (1-(tert-Butoxycarbonyl)-4-methoxy-1H-indol-2-yl)boronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 100mg, 500mg.
[4-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (CAS 1000068-23-4) is a chemical compound with the molecular formula C14H18BNO5 and a molecular weight of 291.11 g/mol. IUPAC name: [4-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. InChIKey: BEXQWPHMBFKSLF-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO5 |
|---|---|
| Molecular weight | 291.11 g/mol |
| IUPAC name | [4-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChIKey | BEXQWPHMBFKSLF-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC=C2OC)(O)O |
Computed by PubChem (NCBI)