cas: 913835-60-6 — see every product listed under this CAS number, including other names
(1-(tert-Butyldimethylsilyl)-1H-indol-6-yl)boronic acid 98% (CAS 913835-60-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A416780-250mg |
| cas | 913835-60-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 576.19 Pln | |
| Ambeed | 5g | 1482.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A416780 |
[1-[tert-butyl(dimethyl)silyl]indol-6-yl]boronic acid (CAS 913835-60-6) is a chemical compound with the molecular formula C14H22BNO2Si and a molecular weight of 275.23 g/mol. IUPAC name: [1-[tert-butyl(dimethyl)silyl]indol-6-yl]boronic acid. InChIKey: KALVCXCOXCPCOZ-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO2Si |
|---|---|
| Molecular weight | 275.23 g/mol |
| IUPAC name | [1-[tert-butyl(dimethyl)silyl]indol-6-yl]boronic acid |
| InChIKey | KALVCXCOXCPCOZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=CN2[Si](C)(C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)