CAS 159590-02-0 is the registry number for (1-[tert-Butyl(dimethyl)silyl]-1h-indol-3-yl)boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
[1-[tert-butyl(dimethyl)silyl]indol-3-yl]boronic acid (CAS 159590-02-0) is a chemical compound with the molecular formula C14H22BNO2Si and a molecular weight of 275.23 g/mol. IUPAC name: [1-[tert-butyl(dimethyl)silyl]indol-3-yl]boronic acid. InChIKey: GSNHHLNDEKIFIZ-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO2Si |
|---|---|
| Molecular weight | 275.23 g/mol |
| IUPAC name | [1-[tert-butyl(dimethyl)silyl]indol-3-yl]boronic acid |
| InChIKey | GSNHHLNDEKIFIZ-UHFFFAOYSA-N |
| SMILES | B(C1=CN(C2=CC=CC=C12)[Si](C)(C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)