CAS 913835-60-6 appears in our catalog under these names: 1-TBDMS-indole-6-boronic acid, 98%, (1-(tert-Butyldimethylsilyl)-1H-indol-6-yl)boronic acid 98%, 1-TBDMS-indole-6-boronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
[1-[tert-butyl(dimethyl)silyl]indol-6-yl]boronic acid (CAS 913835-60-6) is a chemical compound with the molecular formula C14H22BNO2Si and a molecular weight of 275.23 g/mol. IUPAC name: [1-[tert-butyl(dimethyl)silyl]indol-6-yl]boronic acid. InChIKey: KALVCXCOXCPCOZ-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO2Si |
|---|---|
| Molecular weight | 275.23 g/mol |
| IUPAC name | [1-[tert-butyl(dimethyl)silyl]indol-6-yl]boronic acid |
| InChIKey | KALVCXCOXCPCOZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=CN2[Si](C)(C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)