CAS 351457-64-2 appears in our catalog under these names: 1-TBDMS-indole-4-boronic acid, 97%, (1-(tert-Butyldimethylsilyl)-1H-indol-4-yl)boronic acid 98+%, 1-TBDMS-indole-4-boronic acid, 98+%, 98+%, (1-(Tert-butyldimethylsilyl)-1H-indol-4-yl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
[1-[tert-butyl(dimethyl)silyl]indol-4-yl]boronic acid (CAS 351457-64-2) is a chemical compound with the molecular formula C14H22BNO2Si and a molecular weight of 275.23 g/mol. IUPAC name: [1-[tert-butyl(dimethyl)silyl]indol-4-yl]boronic acid. InChIKey: PTZKCFPZTHUQTI-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO2Si |
|---|---|
| Molecular weight | 275.23 g/mol |
| IUPAC name | [1-[tert-butyl(dimethyl)silyl]indol-4-yl]boronic acid |
| InChIKey | PTZKCFPZTHUQTI-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CN(C2=CC=C1)[Si](C)(C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)