cas: 2123477-78-9 — see every product listed under this CAS number, including other names
(1-cyclopropyl-1h-pyrazol-5-yl)boronic acid pinacol ester (CAS 2123477-78-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | YJD47778-50mg |
| cas | 2123477-78-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 50mg | price on request | |
| Biosynth | 0,5g | price on request | |
| Fluorochem | 100mg | 966.34 Pln | |
| Fluorochem | 250mg | 1408.90 Pln | |
| Fluorochem | 1g | 3954.88 Pln | |
| Fluorochem | 5g | 11493.89 Pln | |
| Fluorochem | 10g | 21771.52 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
1-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2123477-78-9) is a chemical compound with the molecular formula C12H19BN2O2 and a molecular weight of 234.10 g/mol. IUPAC name: 1-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: KCDXIJGKLSHKBL-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O2 |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | 1-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | KCDXIJGKLSHKBL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=NN2C3CC3 |
Computed by PubChem (NCBI)