cas: 2123477-78-9 — see every product listed under this CAS number, including other names
1-Cyclopropylpyrazole-5-boronic Acid Pinacol Ester, 97%, 97% (CAS 2123477-78-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AMNK-100mg |
| cas | 2123477-78-9 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 597.20 Pln | |
| Chemat | 250mg | 866.00 Pln | |
| Chemat | 1g | 2070.80 Pln | |
| Chemat | 5g | 5968.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2123477-78-9) is a chemical compound with the molecular formula C12H19BN2O2 and a molecular weight of 234.10 g/mol. IUPAC name: 1-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: KCDXIJGKLSHKBL-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O2 |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | 1-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | KCDXIJGKLSHKBL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=NN2C3CC3 |
Computed by PubChem (NCBI)