cas: 54417-53-7 — see every product listed under this CAS number, including other names
(1R)-1-[(3,4-Dimethoxyphenyl)methyl]-1,2,3,4-tetrahydro-6,7-dimethoxy-isoquinoline hydrochloride, 98%, 98% (CAS 54417-53-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11473V-1g |
| cas | 54417-53-7 |
| size | 1g |
| availability | 861.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 170.00 Pln | |
| Chemat | 25g | 290.00 Pln | |
| Chemat | 100g | 890.00 Pln | |
| Chemat | 500g | 3854.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 54417-53-7) is a chemical compound with the molecular formula C20H26ClNO4 and a molecular weight of 379.9 g/mol. IUPAC name: (1R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: VMPLLPIDRGXFTQ-PKLMIRHRSA-N.
| Molecular formula | C20H26ClNO4 |
|---|---|
| Molecular weight | 379.9 g/mol |
| IUPAC name | (1R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | VMPLLPIDRGXFTQ-PKLMIRHRSA-N |
| SMILES | COC1=C(C=C(C=C1)C[C@@H]2C3=CC(=C(C=C3CCN2)OC)OC)OC.Cl |
Computed by PubChem (NCBI)