(R)-Tetrahydropapaverine (hydrochloride), 99.96%
cas: 54417-53-7 — see every product listed under this CAS number, including other names
(R)-Tetrahydropapaverine (hydrochloride), 99.96% (CAS 54417-53-7) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 25 g, 10mM/1mL, 5 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-N0137A-10 g |
| cas | 54417-53-7 |
| size | 10 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 454.37 Pln | |
| MedChemExpress | 25 g | 793.38 Pln | |
| MedChemExpress | 10mM/1mL | 250.03 Pln | |
| MedChemExpress | 5 g | 361.49 Pln | |
| MedChemExpress | 1 g | 240.74 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.96% |
(1R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 54417-53-7) is a chemical compound with the molecular formula C20H26ClNO4 and a molecular weight of 379.9 g/mol. IUPAC name: (1R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: VMPLLPIDRGXFTQ-PKLMIRHRSA-N.
| Molecular formula | C20H26ClNO4 |
|---|---|
| Molecular weight | 379.9 g/mol |
| IUPAC name | (1R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | VMPLLPIDRGXFTQ-PKLMIRHRSA-N |
| SMILES | COC1=C(C=C(C=C1)C[C@@H]2C3=CC(=C(C=C3CCN2)OC)OC)OC.Cl |
Computed by PubChem (NCBI)
Synonyms:
(R)-1,2,3,4-tetrahydro-6,7-dimethoxy-1-veratrylisoquinoline hydrochloride, R-tetrahydropapaverine HCl, (R)-(-)-Norlaudanosine hydrochloride, (R)-Tetrahydropapaverine (hydrochloride), (R)-1-(3,4-Dimethoxy-benzyl)-6,7-dimethoxy-1,2,3,4-tetrahydro-isoquinoline HCl, (R)-Tetrahydropapaverine hydrochloride, Atracurium Impurity 54, R-TATRAHYDROPAPAVERINE HCL, r-tetrahydropapaverin hydrochloride, VMPLLPIDRGXFTQ-PKLMIRHRSA-N