cas: 54417-53-7 — see every product listed under this CAS number, including other names
(R)-1-(3,4-Dimethoxy-benzyl)-6,7-dimethoxy-1,2,3,4-tetrahydro-isoquinoline hydrochloride, 98% (CAS 54417-53-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F041361-10G |
| cas | 54417-53-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 253.05 Pln | |
| Fluorochem | 25g | 414.46 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(1R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 54417-53-7) is a chemical compound with the molecular formula C20H26ClNO4 and a molecular weight of 379.9 g/mol. IUPAC name: (1R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: VMPLLPIDRGXFTQ-PKLMIRHRSA-N.
| Molecular formula | C20H26ClNO4 |
|---|---|
| Molecular weight | 379.9 g/mol |
| IUPAC name | (1R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | VMPLLPIDRGXFTQ-PKLMIRHRSA-N |
| SMILES | COC1=C(C=C(C=C1)C[C@@H]2C3=CC(=C(C=C3CCN2)OC)OC)OC.Cl |
Computed by PubChem (NCBI)