cas: 13374-31-7 — see every product listed under this CAS number, including other names
(1R,2R)-2-Aminocyclohexanol hydrochloride 97% (CAS 13374-31-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 10g, 25g, 100g, 5g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A320048-250mg |
| cas | 13374-31-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 476.06 Pln | |
| Ambeed | 100g | 1677.56 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 500g | 6500.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A320048 |
Trans-(1R,2R)-2-aminocyclohexan-1-ol;hydrochloride (CAS 13374-31-7) is a chemical compound with the molecular formula C6H14ClNO and a molecular weight of 151.63 g/mol. IUPAC name: trans-(1R,2R)-2-aminocyclohexan-1-ol;hydrochloride. InChIKey: LKKCSUHCVGCGFA-KGZKBUQUSA-N.
| Molecular formula | C6H14ClNO |
|---|---|
| Molecular weight | 151.63 g/mol |
| IUPAC name | trans-(1R,2R)-2-aminocyclohexan-1-ol;hydrochloride |
| InChIKey | LKKCSUHCVGCGFA-KGZKBUQUSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)N)O.Cl |
Computed by PubChem (NCBI)