cas: 1024618-29-8 — see every product listed under this CAS number, including other names
(1R,2R)-Methyl 2-aminocyclohexanecarboxylate hydrochloride 98% (CAS 1024618-29-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A189484-100mg |
| cas | 1024618-29-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 832.06 Pln | |
| Ambeed | 250mg | 1143.56 Pln | |
| Ambeed | 1g | 2244.94 Pln | |
| Ambeed | 5g | 6644.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A189484 |
Trans-methyl (1R,2R)-2-aminocyclohexane-1-carboxylate;hydrochloride (CAS 1024618-29-8) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: trans-methyl (1R,2R)-2-aminocyclohexane-1-carboxylate;hydrochloride. InChIKey: PYKBWUZZPSEGLC-ZJLYAJKPSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | trans-methyl (1R,2R)-2-aminocyclohexane-1-carboxylate;hydrochloride |
| InChIKey | PYKBWUZZPSEGLC-ZJLYAJKPSA-N |
| SMILES | COC(=O)[C@@H]1CCCC[C@H]1N.Cl |
Computed by PubChem (NCBI)