CAS 142547-15-7 appears in our catalog under these names: (1R,2S)-Rel-ethyl 2-aminocyclopentanecarboxylate hydrochloride, 95%, cis–2–Amino–cyclopentanecarboxylic acid ethyl ester hydrochloride, (1R,2S)-rel-Ethyl 2-aminocyclopentanecarboxylate hydrochloride, Ethyl cis-2-amino-1-cyclopentane carboxylate hydrochloride, 99%, (1R,2S)-rel-Ethyl 2-aminocyclopentanecarboxylate hydrochloride, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Thermo Scientific (Acros), Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g, 0,5g, 50mg.
Cis-ethyl (1R,2S)-2-aminocyclopentane-1-carboxylate;hydrochloride (CAS 142547-15-7) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: cis-ethyl (1R,2S)-2-aminocyclopentane-1-carboxylate;hydrochloride. InChIKey: RYBMXCZWUCHLJB-HHQFNNIRSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | cis-ethyl (1R,2S)-2-aminocyclopentane-1-carboxylate;hydrochloride |
| InChIKey | RYBMXCZWUCHLJB-HHQFNNIRSA-N |
| SMILES | CCOC(=O)[C@@H]1CCC[C@@H]1N.Cl |
Computed by PubChem (NCBI)