cas: 54779-58-7 — see every product listed under this CAS number, including other names
(1R,2R)-rel-2-Phenylcyclopropanamine hydrochloride, 98%, 98% (CAS 54779-58-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DDH5-100mg |
| cas | 54779-58-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 621.20 Pln | |
| Chemat | 250mg | 1010.00 Pln | |
| Chemat | 500mg | 1917.20 Pln | |
| Chemat | 1g | 2661.20 Pln | |
| Chemat | 5g | 9290.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Cis-(1R,2R)-2-phenylcyclopropan-1-amine;hydrochloride (CAS 54779-58-7) is a chemical compound with the molecular formula C9H12ClN and a molecular weight of 169.65 g/mol. IUPAC name: cis-(1R,2R)-2-phenylcyclopropan-1-amine;hydrochloride. InChIKey: ZPEFMSTTZXJOTM-VTLYIQCISA-N.
| Molecular formula | C9H12ClN |
|---|---|
| Molecular weight | 169.65 g/mol |
| IUPAC name | cis-(1R,2R)-2-phenylcyclopropan-1-amine;hydrochloride |
| InChIKey | ZPEFMSTTZXJOTM-VTLYIQCISA-N |
| SMILES | C1[C@@H]([C@@H]1N)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)