CAS 1228117-53-0 appears in our catalog under these names: (1S,2S)-2-Phenylcyclopropan-1-amine hydrochloride, 97%, (1S,2S)-2-phenylcyclopropanamine hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
Cis-(1S,2S)-2-phenylcyclopropan-1-amine;hydrochloride (CAS 1228117-53-0) is a chemical compound with the molecular formula C9H12ClN and a molecular weight of 169.65 g/mol. IUPAC name: cis-(1S,2S)-2-phenylcyclopropan-1-amine;hydrochloride. InChIKey: ZPEFMSTTZXJOTM-OZZZDHQUSA-N.
| Molecular formula | C9H12ClN |
|---|---|
| Molecular weight | 169.65 g/mol |
| IUPAC name | cis-(1S,2S)-2-phenylcyclopropan-1-amine;hydrochloride |
| InChIKey | ZPEFMSTTZXJOTM-OZZZDHQUSA-N |
| SMILES | C1[C@H]([C@H]1N)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)