CAS 1228117-50-7 appears in our catalog under these names: (1R,2R)-2-Phenylcyclopropanamine hydrochloride, 95%, (1R,2r)-2-phenylcyclopropanamine,hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
Cis-(1R,2R)-2-phenylcyclopropan-1-amine;hydrochloride (CAS 1228117-50-7) is a chemical compound with the molecular formula C9H12ClN and a molecular weight of 169.65 g/mol. IUPAC name: cis-(1R,2R)-2-phenylcyclopropan-1-amine;hydrochloride. InChIKey: ZPEFMSTTZXJOTM-VTLYIQCISA-N.
| Molecular formula | C9H12ClN |
|---|---|
| Molecular weight | 169.65 g/mol |
| IUPAC name | cis-(1R,2R)-2-phenylcyclopropan-1-amine;hydrochloride |
| InChIKey | ZPEFMSTTZXJOTM-VTLYIQCISA-N |
| SMILES | C1[C@@H]([C@@H]1N)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)