CAS 107077-98-5 appears in our catalog under these names: (±)-Tranylcypromine-d5 HCl (phenyl-d5), 98 atom % D, min 98% Chemical Purity, (rel)–Tranylcypromine D5 hydrochloride, rac trans-2-Phenylcyclopropylamine-d5 Hydrochloride, (1R,2S)-Tranylcypromine-d5 Hydrochloride, Tranylcypromine-d5 (hydrochloride). Offered by: CDN, GLPBio, TRC, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 5mg, 10mg, 1mg, 25mg, 1 mg, 10 mg.
Trans-(1R,2S)-2-(2,3,4,5,6-pentadeuteriophenyl)cyclopropan-1-amine;hydrochloride (CAS 107077-98-5) is a chemical compound with the molecular formula C9H12ClN and a molecular weight of 174.68 g/mol. IUPAC name: trans-(1R,2S)-2-(2,3,4,5,6-pentadeuteriophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: ZPEFMSTTZXJOTM-KMWRGRSGSA-N.
| Molecular formula | C9H12ClN |
|---|---|
| Molecular weight | 174.68 g/mol |
| IUPAC name | trans-(1R,2S)-2-(2,3,4,5,6-pentadeuteriophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | ZPEFMSTTZXJOTM-KMWRGRSGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])[C@@H]2C[C@H]2N)[2H])[2H].Cl |
Computed by PubChem (NCBI)