cas: 497-37-0 — see every product listed under this CAS number, including other names
(1R,2R,4S)-Bicyclo[2.2.1]heptan-2-ol, 98% (CAS 497-37-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F608577-5G |
| cas | 497-37-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 331.15 Pln | |
| Fluorochem | 10g | 539.41 Pln | |
| Fluorochem | 25g | 872.63 Pln | |
| Fluorochem | 100g | 3309.27 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(1S,2S,4R)-bicyclo[2.2.1]heptan-2-ol (CAS 497-37-0) is a chemical compound with the molecular formula C7H12O and a molecular weight of 112.17 g/mol. IUPAC name: (1S,2S,4R)-bicyclo[2.2.1]heptan-2-ol. InChIKey: ZQTYQMYDIHMKQB-VQVTYTSYSA-N.
| Molecular formula | C7H12O |
|---|---|
| Molecular weight | 112.17 g/mol |
| IUPAC name | (1S,2S,4R)-bicyclo[2.2.1]heptan-2-ol |
| InChIKey | ZQTYQMYDIHMKQB-VQVTYTSYSA-N |
| SMILES | C1C[C@H]2C[C@@H]1C[C@@H]2O |
Computed by PubChem (NCBI)