CAS 36779-79-0 appears in our catalog under these names: endo-(-)-2-Norborneol, (1R,2S,4S)-Bicyclo(2.2.1)heptan-2-ol, 98+%, (1R,2S,4S)–Bicyclo(2·2·1)heptan–2–ol. Offered by: TRC, AmBeed, GLPBio. Available pack sizes: 100mg, 1g.
(1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol (CAS 36779-79-0) is a chemical compound with the molecular formula C7H12O and a molecular weight of 112.17 g/mol. IUPAC name: (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol. InChIKey: ZQTYQMYDIHMKQB-XVMARJQXSA-N.
| Molecular formula | C7H12O |
|---|---|
| Molecular weight | 112.17 g/mol |
| IUPAC name | (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol |
| InChIKey | ZQTYQMYDIHMKQB-XVMARJQXSA-N |
| SMILES | C1C[C@@H]2C[C@H]1C[C@@H]2O |
Computed by PubChem (NCBI)