CAS 83572-20-7 appears in our catalog under these names: Rel-(1S,2S,4R)-bicyclo(2.2.1)heptan-2-ol, 98%, exo-norbornan-2-ol, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 25g, 100mg, 250mg, 500mg, 1g, 5g, 10g.
(1S,2S,4R)-bicyclo[2.2.1]heptan-2-ol (CAS 83572-20-7) is a chemical compound with the molecular formula C7H12O and a molecular weight of 112.17 g/mol. IUPAC name: (1S,2S,4R)-bicyclo[2.2.1]heptan-2-ol. InChIKey: ZQTYQMYDIHMKQB-VQVTYTSYSA-N.
| Molecular formula | C7H12O |
|---|---|
| Molecular weight | 112.17 g/mol |
| IUPAC name | (1S,2S,4R)-bicyclo[2.2.1]heptan-2-ol |
| InChIKey | ZQTYQMYDIHMKQB-VQVTYTSYSA-N |
| SMILES | C1C[C@H]2C[C@@H]1C[C@@H]2O |
Computed by PubChem (NCBI)