Products 497-37-0
CAS 497-37-0 appears in our catalog under these names: Exo-norborneol, 98%, exo-Norborneol, exo–Norborneol, exo-Norborneol, >98.0%(GC), Exo-Bicyclo[2.2.1]Heptan-2-Ol, 96%, 96%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Sigma-Aldrich. Available pack sizes: 5g, 1g, 100mg, 500mg, 50mg, 25g, 250mg, 10g.
(1S,2S,4R)-bicyclo[2.2.1]heptan-2-ol (CAS 497-37-0) is a chemical compound with the molecular formula C7H12O and a molecular weight of 112.17 g/mol. IUPAC name: (1S,2S,4R)-bicyclo[2.2.1]heptan-2-ol. InChIKey: ZQTYQMYDIHMKQB-VQVTYTSYSA-N.
| Molecular formula | C7H12O |
|---|---|
| Molecular weight | 112.17 g/mol |
| IUPAC name | (1S,2S,4R)-bicyclo[2.2.1]heptan-2-ol |
| InChIKey | ZQTYQMYDIHMKQB-VQVTYTSYSA-N |
| SMILES | C1C[C@H]2C[C@@H]1C[C@@H]2O |
Computed by PubChem (NCBI)