cas: 1389359-96-9 — see every product listed under this CAS number, including other names
(1R,2R,5S)-3-Boc-3-azabicyclo[3.1.0]hexane-2-carboxylic acid 97% (CAS 1389359-96-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A424184-250mg |
| cas | 1389359-96-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1104.63 Pln | |
| Ambeed | 1g | 2144.81 Pln | |
| Ambeed | 5g | 6294.44 Pln | |
| Ambeed | 10g | 10438.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A424184 |
(1R,2R,5S)-3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.1.0]hexane-2-carboxylic acid (CAS 1389359-96-9) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: (1R,2R,5S)-3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.1.0]hexane-2-carboxylic acid. InChIKey: RTWMQNSZCUYSJJ-BWZBUEFSSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | (1R,2R,5S)-3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
| InChIKey | RTWMQNSZCUYSJJ-BWZBUEFSSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@H]2[C@@H]1C(=O)O |
Computed by PubChem (NCBI)