cas: 88335-86-8 — see every product listed under this CAS number, including other names
(1R,2S)-2-(Methoxycarbonyl)cyclopropane-1-carboxylic acid 95% (CAS 88335-86-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A981204-250mg |
| cas | 88335-86-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 637.38 Pln | |
| Ambeed | 1g | 1460.62 Pln | |
| Ambeed | 5g | 4180.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A981204 |
Cis-(1R,2S)-2-methoxycarbonylcyclopropane-1-carboxylic acid (CAS 88335-86-8) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 144.12 g/mol. IUPAC name: cis-(1R,2S)-2-methoxycarbonylcyclopropane-1-carboxylic acid. InChIKey: IRRAJLZEAOBJIV-DMTCNVIQSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 144.12 g/mol |
| IUPAC name | cis-(1R,2S)-2-methoxycarbonylcyclopropane-1-carboxylic acid |
| InChIKey | IRRAJLZEAOBJIV-DMTCNVIQSA-N |
| SMILES | COC(=O)[C@H]1C[C@H]1C(=O)O |
Computed by PubChem (NCBI)