CAS 31420-47-0 appears in our catalog under these names: (1S,2R)-Rel-2-(methoxycarbonyl)cyclopropane-1-carboxylic acid, 95%, (1S,2R)-rel-2-(methoxycarbonyl)cyclopropane-1-carboxylic acid 98%, (1S,2R)-rel-2-(Methoxycarbonyl)cyclopropanecarboxylic acid, 98%, 98%, rel-((1S,2R)-2-(Methoxycarbonyl)cyclopropane-1-carboxylic acid), 97.23%, (1S,2R)-rel-2-(methoxycarbonyl)cyclopropane-1-carboxylic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g, 5 g, 250 mg, 1 g.
Cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid (CAS 31420-47-0) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 144.12 g/mol. IUPAC name: cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid. InChIKey: IRRAJLZEAOBJIV-IUYQGCFVSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 144.12 g/mol |
| IUPAC name | cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid |
| InChIKey | IRRAJLZEAOBJIV-IUYQGCFVSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H]1C(=O)O |
Computed by PubChem (NCBI)