cas: 88335-86-8 — see every product listed under this CAS number, including other names
(1R,2S)-2-Methoxycarbonylcyclopropane-1-Carboxylic Acid, 95%, 95% (CAS 88335-86-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11JPVO-250mg |
| cas | 88335-86-8 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 515.60 Pln | |
| Chemat | 1g | 1182.80 Pln | |
| Chemat | 5g | 3990.80 Pln | |
| Chemat | 25g | 17733.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Cis-(1R,2S)-2-methoxycarbonylcyclopropane-1-carboxylic acid (CAS 88335-86-8) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 144.12 g/mol. IUPAC name: cis-(1R,2S)-2-methoxycarbonylcyclopropane-1-carboxylic acid. InChIKey: IRRAJLZEAOBJIV-DMTCNVIQSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 144.12 g/mol |
| IUPAC name | cis-(1R,2S)-2-methoxycarbonylcyclopropane-1-carboxylic acid |
| InChIKey | IRRAJLZEAOBJIV-DMTCNVIQSA-N |
| SMILES | COC(=O)[C@H]1C[C@H]1C(=O)O |
Computed by PubChem (NCBI)