CAS 88335-87-9 appears in our catalog under these names: (1S,2R)-2-(Methoxycarbonyl)cyclopropane-1-carboxylic acid, 95%, (1S,2R)-2-(Methoxycarbonyl)cyclopropane-1-carboxylic acid, 97%, (1S,2R)-2-(Methoxycarbonyl)cyclopropane-1-carboxylic acid ee, (1S,2R)-2-(Methoxycarbonyl)cyclopropane-1-carboxylic acid 97%, 1-Methyl (1R,2S)-1,2-cyclopropanedicarboxylate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 500mg, 1000mg, 2000mg, 5000mg, 5g.
Cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid (CAS 88335-87-9) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 144.12 g/mol. IUPAC name: cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid. InChIKey: IRRAJLZEAOBJIV-IUYQGCFVSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 144.12 g/mol |
| IUPAC name | cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid |
| InChIKey | IRRAJLZEAOBJIV-IUYQGCFVSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H]1C(=O)O |
Computed by PubChem (NCBI)