cas: 16052-40-7 — see every product listed under this CAS number, including other names
(1R,2S,5R)-2-Isopropyl-5-methylcyclohexanecarboxylic acid, 95% (CAS 16052-40-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100g, 500g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | OR-7135-10g |
| cas | 16052-40-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 5g | 294.71 Pln | |
| Fluorochem | 25g | 1049.65 Pln | |
| Fluorochem | 100g | 3663.31 Pln | |
| Fluorochem | 500g | 15909.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid (CAS 16052-40-7) is a chemical compound with the molecular formula C11H20O2 and a molecular weight of 184.27 g/mol. IUPAC name: (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid. InChIKey: MNVSUVYRIVXDBK-KXUCPTDWSA-N.
| Molecular formula | C11H20O2 |
|---|---|
| Molecular weight | 184.27 g/mol |
| IUPAC name | (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid |
| InChIKey | MNVSUVYRIVXDBK-KXUCPTDWSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)C(=O)O)C(C)C |
Computed by PubChem (NCBI)