Products 2375248-16-9

CAS 2375248-16-9 is the registry number for Rac-(1r,2s,5s)-5-methyl-2-(propan-2-yl)cyclohexane-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid (CAS 2375248-16-9) is a chemical compound with the molecular formula C11H20O2 and a molecular weight of 184.27 g/mol. IUPAC name: (1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid. InChIKey: MNVSUVYRIVXDBK-LPEHRKFASA-N.

Identity
Molecular formulaC11H20O2
Molecular weight184.27 g/mol
IUPAC name(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid
InChIKeyMNVSUVYRIVXDBK-LPEHRKFASA-N
SMILESC[C@H]1CC[C@H]([C@@H](C1)C(=O)O)C(C)C

Computed by PubChem (NCBI)