cas: 2231664-84-7 — see every product listed under this CAS number, including other names
(1R,2S,5R)-8-(tert-butoxycarbonyl)-8-azabicyclo[3.2.1]Octane-2-carboxylic acid, 98% (CAS 2231664-84-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg, 500mg. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F552904-100MG |
| cas | 2231664-84-7 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1106.92 Pln | |
| Fluorochem | 250mg | 2132.60 Pln | |
| Fluorochem | 1g | 6443.58 Pln | |
| Fluorochem | 5g | 19220.33 Pln | |
| Chemat | 50mg | 645.20 Pln | |
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1658.00 Pln | |
| Chemat | 500mg | 3246.80 Pln | |
| Chemat | 1g | 5022.80 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(1R,2S,5R)-8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]octane-2-carboxylic acid (CAS 2231664-84-7) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: (1R,2S,5R)-8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]octane-2-carboxylic acid. InChIKey: FBRWVUWBHWKVEH-KXUCPTDWSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | (1R,2S,5R)-8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]octane-2-carboxylic acid |
| InChIKey | FBRWVUWBHWKVEH-KXUCPTDWSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@@H]([C@H]1CC2)C(=O)O |
Computed by PubChem (NCBI)