cas: 489446-72-2 — see every product listed under this CAS number, including other names
(1R,3R)-Methyl 3-((tert-butoxycarbonyl)amino)cyclopentanecarboxylate, 97% (CAS 489446-72-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A420529-100mg |
| cas | 489446-72-2 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 459.38 Pln | |
| Ambeed | 250mg | 848.75 Pln | |
| Ambeed | 1g | 2189.31 Pln | |
| Ambeed | 5g | 7473.69 Pln | |
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 573.20 Pln | |
| Chemat | 1g | 1941.20 Pln | |
| Chemat | 5g | 6640.40 Pln | |
| BLDpharm | 100mg | 492.07 Pln | |
| BLDpharm | 250mg | 908.59 Pln | |
| BLDpharm | 1g | 2352.53 Pln | |
| BLDpharm | 5g | 8044.97 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Trans-methyl (1R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylate (CAS 489446-72-2) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: trans-methyl (1R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylate. InChIKey: ZZGMDDXYOHHJMT-RKDXNWHRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | trans-methyl (1R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylate |
| InChIKey | ZZGMDDXYOHHJMT-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@H](C1)C(=O)OC |
Computed by PubChem (NCBI)