CAS 173464-47-6 is the registry number for Methyl (1r,3s)-3-([(tert-butoxy)carbonyl]amino)cyclopentane-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Cis-methyl (1R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylate (CAS 173464-47-6) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: cis-methyl (1R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylate. InChIKey: ZZGMDDXYOHHJMT-BDAKNGLRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | cis-methyl (1R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylate |
| InChIKey | ZZGMDDXYOHHJMT-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@H](C1)C(=O)OC |
Computed by PubChem (NCBI)