cas: 1392804-16-8 — see every product listed under this CAS number, including other names
(1R,3S)-rel-Methyl 3-amino-2,2-dimethylcyclobutanecarboxylate hydrochloride, 97%, 97% (CAS 1392804-16-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112AN7-100mg |
| cas | 1392804-16-8 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1288.40 Pln | |
| Chemat | 250mg | 2022.80 Pln | |
| Chemat | 500mg | 3333.20 Pln | |
| Chemat | 1g | 4965.20 Pln | |
| Chemat | 5g | 14766.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Trans-methyl (1R,3S)-3-amino-2,2-dimethylcyclobutane-1-carboxylate;hydrochloride (CAS 1392804-16-8) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: trans-methyl (1R,3S)-3-amino-2,2-dimethylcyclobutane-1-carboxylate;hydrochloride. InChIKey: YNGIJCQPNBJXTP-GEMLJDPKSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | trans-methyl (1R,3S)-3-amino-2,2-dimethylcyclobutane-1-carboxylate;hydrochloride |
| InChIKey | YNGIJCQPNBJXTP-GEMLJDPKSA-N |
| SMILES | CC1([C@@H](C[C@@H]1N)C(=O)OC)C.Cl |
Computed by PubChem (NCBI)