cas: 1846582-38-4 — see every product listed under this CAS number, including other names
(1R,3s)-3-aminocyclopentanol,benzoic acid, 97% (CAS 1846582-38-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1225213-25g |
| cas | 1846582-38-4 |
| size | 25g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 11202.10 Pln | |
| AmBeed | 100mg | 473.62 Pln | |
| Fluorochem | 100mg | 544.62 Pln | |
| Fluorochem | 250mg | 695.61 Pln | |
| Fluorochem | 500mg | 1091.30 Pln | |
| Fluorochem | 1g | 1601.54 Pln | |
| Fluorochem | 5g | 4548.42 Pln | |
| Fluorochem | 10g | 7380.75 Pln | |
| Fluorochem | 25g | 12212.38 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Benzoic acid;cis-(1R,3S)-3-aminocyclopentan-1-ol (CAS 1846582-38-4) is a chemical compound with the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. IUPAC name: benzoic acid;cis-(1R,3S)-3-aminocyclopentan-1-ol. InChIKey: GXTKQBJGULXMIV-ZBTZCESGSA-N.
| Molecular formula | C12H17NO3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | benzoic acid;cis-(1R,3S)-3-aminocyclopentan-1-ol |
| InChIKey | GXTKQBJGULXMIV-ZBTZCESGSA-N |
| SMILES | C1C[C@H](C[C@H]1N)O.C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)