CAS 1846582-38-4 appears in our catalog under these names: (1R,3s)-3-aminocyclopentanol,benzoic acid, 97%, (1R,3s)-3-aminocyclopentanol,benzoic acid, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 100mg, 250mg, 500mg, 1g, 5g, 10g.
Benzoic acid;cis-(1R,3S)-3-aminocyclopentan-1-ol (CAS 1846582-38-4) is a chemical compound with the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. IUPAC name: benzoic acid;cis-(1R,3S)-3-aminocyclopentan-1-ol. InChIKey: GXTKQBJGULXMIV-ZBTZCESGSA-N.
| Molecular formula | C12H17NO3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | benzoic acid;cis-(1R,3S)-3-aminocyclopentan-1-ol |
| InChIKey | GXTKQBJGULXMIV-ZBTZCESGSA-N |
| SMILES | C1C[C@H](C[C@H]1N)O.C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)