cas: 130931-85-0 — see every product listed under this CAS number, including other names
(1R,4S)-4-Aminocyclopent-2-enecarboxylic acid hydrochloride, 97%, 97% (CAS 130931-85-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111V64-100mg |
| cas | 130931-85-0 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 400.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(1R,4S)-4-aminocyclopent-2-ene-1-carboxylic acid;hydrochloride (CAS 130931-85-0) is a chemical compound with the molecular formula C6H10ClNO2 and a molecular weight of 163.60 g/mol. IUPAC name: (1R,4S)-4-aminocyclopent-2-ene-1-carboxylic acid;hydrochloride. InChIKey: JYDJHYGBXSCMJL-UYXJWNHNSA-N.
| Molecular formula | C6H10ClNO2 |
|---|---|
| Molecular weight | 163.60 g/mol |
| IUPAC name | (1R,4S)-4-aminocyclopent-2-ene-1-carboxylic acid;hydrochloride |
| InChIKey | JYDJHYGBXSCMJL-UYXJWNHNSA-N |
| SMILES | C1[C@H](C=C[C@H]1N)C(=O)O.Cl |
Computed by PubChem (NCBI)