cas: 130931-85-0 — see every product listed under this CAS number, including other names
(1R,4S)-4-Aminocyclopent-2-enecarboxylic acid hydrochloride, 97% (CAS 130931-85-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A768722-250mg |
| cas | 130931-85-0 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 447.58 Pln | |
| AmBeed | 100mg | 382.48 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(1R,4S)-4-aminocyclopent-2-ene-1-carboxylic acid;hydrochloride (CAS 130931-85-0) is a chemical compound with the molecular formula C6H10ClNO2 and a molecular weight of 163.60 g/mol. IUPAC name: (1R,4S)-4-aminocyclopent-2-ene-1-carboxylic acid;hydrochloride. InChIKey: JYDJHYGBXSCMJL-UYXJWNHNSA-N.
| Molecular formula | C6H10ClNO2 |
|---|---|
| Molecular weight | 163.60 g/mol |
| IUPAC name | (1R,4S)-4-aminocyclopent-2-ene-1-carboxylic acid;hydrochloride |
| InChIKey | JYDJHYGBXSCMJL-UYXJWNHNSA-N |
| SMILES | C1[C@H](C=C[C@H]1N)C(=O)O.Cl |
Computed by PubChem (NCBI)