cas: 130931-85-0 — see every product listed under this CAS number, including other names
(1R,4S)-4-Aminocyclopentane-2-encarboxylic acid hydrochloride, 97% (CAS 130931-85-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F608815-100MG |
| cas | 130931-85-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 96.86 Pln | |
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 190.58 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1R,4S)-4-aminocyclopent-2-ene-1-carboxylic acid;hydrochloride (CAS 130931-85-0) is a chemical compound with the molecular formula C6H10ClNO2 and a molecular weight of 163.60 g/mol. IUPAC name: (1R,4S)-4-aminocyclopent-2-ene-1-carboxylic acid;hydrochloride. InChIKey: JYDJHYGBXSCMJL-UYXJWNHNSA-N.
| Molecular formula | C6H10ClNO2 |
|---|---|
| Molecular weight | 163.60 g/mol |
| IUPAC name | (1R,4S)-4-aminocyclopent-2-ene-1-carboxylic acid;hydrochloride |
| InChIKey | JYDJHYGBXSCMJL-UYXJWNHNSA-N |
| SMILES | C1[C@H](C=C[C@H]1N)C(=O)O.Cl |
Computed by PubChem (NCBI)