cas: 652148-14-6 — see every product listed under this CAS number, including other names
(1R,5S,7R)-TERT-BUTYL 7-HYDROXY-3-OXA-9-AZABICYCLO[3.3.1]NONANE-9-CARBOXYLATE, 97% (CAS 652148-14-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F504906-100MG |
| cas | 652148-14-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2601.19 Pln | |
| Fluorochem | 250mg | 4121.48 Pln | |
| Fluorochem | 500mg | 6349.87 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (1S,5R)-7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate (CAS 652148-14-6) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: tert-butyl (1S,5R)-7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate. InChIKey: WKBWNRUVSJJEAM-ULKQDVFKSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | tert-butyl (1S,5R)-7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| InChIKey | WKBWNRUVSJJEAM-ULKQDVFKSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC(C[C@H]1COC2)O |
Computed by PubChem (NCBI)