cas: 652148-14-6 — see every product listed under this CAS number, including other names
(1R,5S,7R)-tert-butyl 7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate, 97%, 97% (CAS 652148-14-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IBGZ-100mg |
| cas | 652148-14-6 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1586.00 Pln | |
| Chemat | 250mg | 2502.80 Pln | |
| Chemat | 500mg | 4115.60 Pln | |
| Chemat | 1g | 6146.00 Pln | |
| Chemat | 5g | 18309.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (1S,5R)-7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate (CAS 652148-14-6) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: tert-butyl (1S,5R)-7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate. InChIKey: WKBWNRUVSJJEAM-ULKQDVFKSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | tert-butyl (1S,5R)-7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| InChIKey | WKBWNRUVSJJEAM-ULKQDVFKSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC(C[C@H]1COC2)O |
Computed by PubChem (NCBI)