cas: 259214-55-6 — see every product listed under this CAS number, including other names
(1S,2R)-1-((tert-Butoxycarbonyl)amino)-2-vinylcyclopropanecarboxylic acid 95% mix TBC as stabilizer (CAS 259214-55-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A253823-100mg |
| cas | 259214-55-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 370.38 Pln | |
| Ambeed | 5g | 954.44 Pln |
| purity | 95% mix TBC as stabilizer |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A253823 |
Trans-(1S,2R)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid (CAS 259214-55-6) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: trans-(1S,2R)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid. InChIKey: RFAQWADNTLIWMG-CPCISQLKSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | trans-(1S,2R)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid |
| InChIKey | RFAQWADNTLIWMG-CPCISQLKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@]1(C[C@@H]1C=C)C(=O)O |
Computed by PubChem (NCBI)